About N-tert-butyl-2-chloro-4,5-difluorobenzamide
N-tert-butyl-2-chloro-4,5-difluorobenzamide (PubChem CID 2113232) has the molecular formula C11H12ClF2NO
and a molecular weight of 247.67 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-4,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-chloro-4,5-difluorobenzamide |
| PubChem CID | 2113232 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-tert-butyl-2-chloro-4,5-difluorobenzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H12ClF2NO/c1-11(2,3)15-10(16)6-4-8(13)9(14)5-7(6)12/h4-5H,1-3H3,(H,15,16) |
| InChIKey | DIYXQHFPFJPIAE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-chloro-4,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-chloro-4,5-difluorobenzamide?
The IUPAC name of N-tert-butyl-2-chloro-4,5-difluorobenzamide (CID 2113232) is N-tert-butyl-2-chloro-4,5-difluorobenzamide.
What is the SMILES notation for N-tert-butyl-2-chloro-4,5-difluorobenzamide?
The canonical SMILES for N-tert-butyl-2-chloro-4,5-difluorobenzamide is CC(C)(C)NC(=O)c1cc(F)c(F)cc1Cl.
What is the InChIKey of N-tert-butyl-2-chloro-4,5-difluorobenzamide?
The InChIKey is DIYXQHFPFJPIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF2NO/c1-11(2,3)15-10(16)6-4-8(13)9(14)5-7(6)12/h4-5H,1-3H3,(H,15,16).
What are the key properties of N-tert-butyl-2-chloro-4,5-difluorobenzamide?
N-tert-butyl-2-chloro-4,5-difluorobenzamide has a molecular weight of 247.67 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-chloro-4,5-difluorobenzamide is sourced from PubChem (CID 2113232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).