About (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+)
(1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) (PubChem CID 21132335) has the molecular formula C7H8F3NO3SW
and a molecular weight of 427.05 g/mol. Its IUPAC name is (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+).
Molecular Properties
| Compound Name | (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) |
| PubChem CID | 21132335 |
| Molecular Formula | C7H8F3NO3SW |
| Molecular Weight | 427.05 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) |
| SMILES | CN1[CH-]C=C(OS(=O)(=O)C(F)(F)F)C[CH-]1.[W+2] |
| InChI | InChI=1S/C7H8F3NO3S.W/c1-11-4-2-6(3-5-11)14-15(12,13)7(8,9)10;/h2,4-5H,3H2,1H3;/q-2;+2 |
| InChIKey | JQAJCUGECHLBPN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.05 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+)?
The IUPAC name of (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) (CID 21132335) is (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+).
What is the SMILES notation for (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+)?
The canonical SMILES for (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) is CN1[CH-]C=C(OS(=O)(=O)C(F)(F)F)C[CH-]1.[W+2].
What is the InChIKey of (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+)?
The InChIKey is JQAJCUGECHLBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO3S.W/c1-11-4-2-6(3-5-11)14-15(12,13)7(8,9)10;/h2,4-5H,3H2,1H3;/q-2;+2.
What are the key properties of (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+)?
(1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) has a molecular weight of 427.05 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,6-dihydro-2H-pyridine-2,6-diid-4-yl) trifluoromethanesulfonate;tungsten(2+) is sourced from PubChem (CID 21132335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).