C22H31NO5S — CID 21132781
7-[2-[3-(1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 21132781) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is 7-[2-[3-(1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[3-(1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 21132781 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 7-[2-[3-(1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)CC(O)C1CCC(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H31NO5S/c24-17(22-23-16-8-5-6-9-20(16)29-22)12-11-15-14(18(25)13-19(15)26)7-3-1-2-4-10-21(27)28/h5-6,8-9,14-15,17-19,24-26H,1-4,7,10-13H2,(H,27,28) |
| InChIKey | FUUQYYSQBLWYLA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|