C25H36FNO5S — CID 21132816
propan-2-yl 7-[2-[3-(5-fluoro-1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate (PubChem CID 21132816) has the molecular formula C25H36FNO5S and a molecular weight of 481.63 g/mol. Its IUPAC name is propan-2-yl 7-[2-[3-(5-fluoro-1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[2-[3-(5-fluoro-1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 21132816 |
| Molecular Formula | C25H36FNO5S |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | propan-2-yl 7-[2-[3-(5-fluoro-1,3-benzothiazol-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCC1C(O)CC(O)C1CCC(O)c1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C25H36FNO5S/c1-15(2)32-24(31)8-6-4-3-5-7-17-18(22(30)14-21(17)29)10-11-20(28)25-27-19-13-16(26)9-12-23(19)33-25/h9,12-13,15,17-18,20-22,28-30H,3-8,10-11,14H2,1-2H3 |
| InChIKey | NJKMLFPFODVQHG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|