About 1,4-ditert-butyl-2,3-dimethyl-2H-azete
1,4-ditert-butyl-2,3-dimethyl-2H-azete (PubChem CID 21133051) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,3-dimethyl-2H-azete.
Molecular Properties
| Compound Name | 1,4-ditert-butyl-2,3-dimethyl-2H-azete |
| PubChem CID | 21133051 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1,4-ditert-butyl-2,3-dimethyl-2H-azete |
| SMILES | CC1=C(C(C)(C)C)N(C(C)(C)C)C1C |
| InChI | InChI=1S/C13H25N/c1-9-10(2)14(13(6,7)8)11(9)12(3,4)5/h10H,1-8H3 |
| InChIKey | WHXSMNYDXBDYGE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-ditert-butyl-2,3-dimethyl-2H-azete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butyl-2,3-dimethyl-2H-azete?
The IUPAC name of 1,4-ditert-butyl-2,3-dimethyl-2H-azete (CID 21133051) is 1,4-ditert-butyl-2,3-dimethyl-2H-azete.
What is the SMILES notation for 1,4-ditert-butyl-2,3-dimethyl-2H-azete?
The canonical SMILES for 1,4-ditert-butyl-2,3-dimethyl-2H-azete is CC1=C(C(C)(C)C)N(C(C)(C)C)C1C.
What is the InChIKey of 1,4-ditert-butyl-2,3-dimethyl-2H-azete?
The InChIKey is WHXSMNYDXBDYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-9-10(2)14(13(6,7)8)11(9)12(3,4)5/h10H,1-8H3.
What are the key properties of 1,4-ditert-butyl-2,3-dimethyl-2H-azete?
1,4-ditert-butyl-2,3-dimethyl-2H-azete has a molecular weight of 195.35 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butyl-2,3-dimethyl-2H-azete is sourced from PubChem (CID 21133051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).