About 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide
1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide (PubChem CID 21133161) has the molecular formula C12H16N2O2S2
and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide |
| PubChem CID | 21133161 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCS)c1cccc(C(=O)NCCS)c1 |
| InChI | InChI=1S/C12H16N2O2S2/c15-11(13-4-6-17)9-2-1-3-10(8-9)12(16)14-5-7-18/h1-3,8,17-18H,4-7H2,(H,13,15)(H,14,16) |
| InChIKey | JUTBAVRYDAKVGQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide?
The IUPAC name of 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide (CID 21133161) is 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide?
The canonical SMILES for 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide is O=C(NCCS)c1cccc(C(=O)NCCS)c1.
What is the InChIKey of 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide?
The InChIKey is JUTBAVRYDAKVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2S2/c15-11(13-4-6-17)9-2-1-3-10(8-9)12(16)14-5-7-18/h1-3,8,17-18H,4-7H2,(H,13,15)(H,14,16).
What are the key properties of 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide?
1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide has a molecular weight of 284.41 g/mol, XLogP of 1.01, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(2-sulfanylethyl)benzene-1,3-dicarboxamide is sourced from PubChem (CID 21133161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).