C30H30F4O2 — CID 21133254
8-(4-fluorophenyl)-6-propan-2-yl-7-[4-(trifluoromethyl)benzoyl]spiro[2,4,4a,7,8,8a-hexahydronaphthalene-3,1'-cyclobutane]-1-one (PubChem CID 21133254) has the molecular formula C30H30F4O2 and a molecular weight of 498.56 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-6-propan-2-yl-7-[4-(trifluoromethyl)benzoyl]spiro[2,4,4a,7,8,8a-hexahydronaphthalene-3,1'-cyclobutane]-1-one.
| Compound Name | 8-(4-fluorophenyl)-6-propan-2-yl-7-[4-(trifluoromethyl)benzoyl]spiro[2,4,4a,7,8,8a-hexahydronaphthalene-3,1'-cyclobutane]-1-one |
|---|---|
| PubChem CID | 21133254 |
| Molecular Formula | C30H30F4O2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 8-(4-fluorophenyl)-6-propan-2-yl-7-[4-(trifluoromethyl)benzoyl]spiro[2,4,4a,7,8,8a-hexahydronaphthalene-3,1'-cyclobutane]-1-one |
| SMILES | CC(C)C1=CC2CC3(CCC3)CC(=O)C2C(c2ccc(F)cc2)C1C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H30F4O2/c1-17(2)23-14-20-15-29(12-3-13-29)16-24(35)25(20)26(18-6-10-22(31)11-7-18)27(23)28(36)19-4-8-21(9-5-19)30(32,33)34/h4-11,14,17,20,25-27H,3,12-13,15-16H2,1-2H3 |
| InChIKey | KLAFYCZLDUMRDM-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|