About 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid
2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid (PubChem CID 21133604) has the molecular formula C14H26O6
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid.
Molecular Properties
| Compound Name | 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid |
| PubChem CID | 21133604 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid |
| SMILES | CC(C(OO)C(=O)O)C(C)C(OO)C1(C)CCCCC1 |
| InChI | InChI=1S/C14H26O6/c1-9(11(19-17)13(15)16)10(2)12(20-18)14(3)7-5-4-6-8-14/h9-12,17-18H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | ZUFLQGXUWNSPEV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid?
The IUPAC name of 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid (CID 21133604) is 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid.
What is the SMILES notation for 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid?
The canonical SMILES for 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid is CC(C(OO)C(=O)O)C(C)C(OO)C1(C)CCCCC1.
What is the InChIKey of 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid?
The InChIKey is ZUFLQGXUWNSPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O6/c1-9(11(19-17)13(15)16)10(2)12(20-18)14(3)7-5-4-6-8-14/h9-12,17-18H,4-8H2,1-3H3,(H,15,16).
What are the key properties of 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid?
2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid has a molecular weight of 290.36 g/mol, XLogP of 3.03, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydroperoxy-3,4-dimethyl-5-(1-methylcyclohexyl)pentanoic acid is sourced from PubChem (CID 21133604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).