C20H36O5 — CID 21133619
3-(2-ethylbutyl)-4-(4-hydroperoxy-3,5,5-trimethylheptyl)oxolane-2,5-dione (PubChem CID 21133619) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is 3-(2-ethylbutyl)-4-(4-hydroperoxy-3,5,5-trimethylheptyl)oxolane-2,5-dione.
| Compound Name | 3-(2-ethylbutyl)-4-(4-hydroperoxy-3,5,5-trimethylheptyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 21133619 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 3-(2-ethylbutyl)-4-(4-hydroperoxy-3,5,5-trimethylheptyl)oxolane-2,5-dione |
| SMILES | CCC(CC)CC1C(=O)OC(=O)C1CCC(C)C(OO)C(C)(C)CC |
| InChI | InChI=1S/C20H36O5/c1-7-14(8-2)12-16-15(18(21)24-19(16)22)11-10-13(4)17(25-23)20(5,6)9-3/h13-17,23H,7-12H2,1-6H3 |
| InChIKey | RLZPMROIHMPPTH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|