C22H38O5 — CID 21133621
3-(2-ethylbutyl)-4-[4-hydroperoxy-3-methyl-4-(1-methylcyclohexyl)butyl]oxolane-2,5-dione (PubChem CID 21133621) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 3-(2-ethylbutyl)-4-[4-hydroperoxy-3-methyl-4-(1-methylcyclohexyl)butyl]oxolane-2,5-dione.
| Compound Name | 3-(2-ethylbutyl)-4-[4-hydroperoxy-3-methyl-4-(1-methylcyclohexyl)butyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 21133621 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 3-(2-ethylbutyl)-4-[4-hydroperoxy-3-methyl-4-(1-methylcyclohexyl)butyl]oxolane-2,5-dione |
| SMILES | CCC(CC)CC1C(=O)OC(=O)C1CCC(C)C(OO)C1(C)CCCCC1 |
| InChI | InChI=1S/C22H38O5/c1-5-16(6-2)14-18-17(20(23)26-21(18)24)11-10-15(3)19(27-25)22(4)12-8-7-9-13-22/h15-19,25H,5-14H2,1-4H3 |
| InChIKey | NQMQXEZEIFGPSV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|