C21H38O5 — CID 21133622
3-(2-ethylbutyl)-4-(5-ethyl-4-hydroperoxy-3,5-dimethylheptyl)oxolane-2,5-dione (PubChem CID 21133622) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is 3-(2-ethylbutyl)-4-(5-ethyl-4-hydroperoxy-3,5-dimethylheptyl)oxolane-2,5-dione.
| Compound Name | 3-(2-ethylbutyl)-4-(5-ethyl-4-hydroperoxy-3,5-dimethylheptyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 21133622 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 3-(2-ethylbutyl)-4-(5-ethyl-4-hydroperoxy-3,5-dimethylheptyl)oxolane-2,5-dione |
| SMILES | CCC(CC)CC1C(=O)OC(=O)C1CCC(C)C(OO)C(C)(CC)CC |
| InChI | InChI=1S/C21H38O5/c1-7-15(8-2)13-17-16(19(22)25-20(17)23)12-11-14(5)18(26-24)21(6,9-3)10-4/h14-18,24H,7-13H2,1-6H3 |
| InChIKey | WUUIECGMOXIXFO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|