About N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide
N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide (PubChem CID 21133730) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide |
| PubChem CID | 21133730 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1C2CCC(C2)C1(C)C |
| InChI | InChI=1S/C13H21NO/c1-4-12(15)14-8-11-9-5-6-10(7-9)13(11,2)3/h4,9-11H,1,5-8H2,2-3H3,(H,14,15) |
| InChIKey | FEQCDEANJHITII-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide?
The IUPAC name of N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide (CID 21133730) is N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide.
What is the SMILES notation for N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide?
The canonical SMILES for N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide is C=CC(=O)NCC1C2CCC(C2)C1(C)C.
What is the InChIKey of N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide?
The InChIKey is FEQCDEANJHITII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-4-12(15)14-8-11-9-5-6-10(7-9)13(11,2)3/h4,9-11H,1,5-8H2,2-3H3,(H,14,15).
What are the key properties of N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide?
N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide has a molecular weight of 207.32 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl]prop-2-enamide is sourced from PubChem (CID 21133730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).