C23H27NO4S — CID 21133785
6-[(2-tert-butyl-4-methyl-1,3-benzothiazol-5-yl)-hydroxymethylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 21133785) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is 6-[(2-tert-butyl-4-methyl-1,3-benzothiazol-5-yl)-hydroxymethylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[(2-tert-butyl-4-methyl-1,3-benzothiazol-5-yl)-hydroxymethylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 21133785 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 6-[(2-tert-butyl-4-methyl-1,3-benzothiazol-5-yl)-hydroxymethylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | Cc1c(C(O)=C2C(=O)C(C)(C)C(=O)C(C)(C)C2=O)ccc2sc(C(C)(C)C)nc12 |
| InChI | InChI=1S/C23H27NO4S/c1-11-12(9-10-13-15(11)24-20(29-13)21(2,3)4)16(25)14-17(26)22(5,6)19(28)23(7,8)18(14)27/h9-10,25H,1-8H3 |
| InChIKey | YLLNKJQUATWQBN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|