C28H36ClN3O — CID 21133909
(4-benzylpiperidin-1-yl)-[6-chloro-1-[3-(diethylamino)propyl]indol-5-yl]methanone (PubChem CID 21133909) has the molecular formula C28H36ClN3O and a molecular weight of 466.07 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[6-chloro-1-[3-(diethylamino)propyl]indol-5-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[6-chloro-1-[3-(diethylamino)propyl]indol-5-yl]methanone |
|---|---|
| PubChem CID | 21133909 |
| Molecular Formula | C28H36ClN3O |
| Molecular Weight | 466.07 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[6-chloro-1-[3-(diethylamino)propyl]indol-5-yl]methanone |
| SMILES | CCN(CC)CCCn1ccc2cc(C(=O)N3CCC(Cc4ccccc4)CC3)c(Cl)cc21 |
| InChI | InChI=1S/C28H36ClN3O/c1-3-30(4-2)14-8-15-31-18-13-24-20-25(26(29)21-27(24)31)28(33)32-16-11-23(12-17-32)19-22-9-6-5-7-10-22/h5-7,9-10,13,18,20-21,23H,3-4,8,11-12,14-17,19H2,1-2H3 |
| InChIKey | DBIUSEDYAXOJSH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.07 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |