C23H40N2O4 — CID 21134251
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylidenebutanedioate (PubChem CID 21134251) has the molecular formula C23H40N2O4 and a molecular weight of 408.58 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylidenebutanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 21134251 |
| Molecular Formula | C23H40N2O4 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H40N2O4/c1-15(19(27)29-17-13-22(6,7)25-23(8,9)14-17)10-18(26)28-16-11-20(2,3)24-21(4,5)12-16/h16-17,24-25H,1,10-14H2,2-9H3 |
| InChIKey | GRKOEMFZBWYVSJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|