C24H18Cl2F2N4O2 — CID 2113443
(2S)-10,12-dichloro-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene (PubChem CID 2113443) has the molecular formula C24H18Cl2F2N4O2 and a molecular weight of 503.34 g/mol. Its IUPAC name is (2S)-10,12-dichloro-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene.
| Compound Name | (2S)-10,12-dichloro-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
|---|---|
| PubChem CID | 2113443 |
| Molecular Formula | C24H18Cl2F2N4O2 |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | (2S)-10,12-dichloro-2-[4-(difluoromethoxy)-3-methoxyphenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
| SMILES | COc1cc([C@H]2c3c(C)nn(-c4ccccc4)c3N=C3C(Cl)=CC(Cl)=CN32)ccc1OC(F)F |
| InChI | InChI=1S/C24H18Cl2F2N4O2/c1-13-20-21(14-8-9-18(34-24(27)28)19(10-14)33-2)31-12-15(25)11-17(26)22(31)29-23(20)32(30-13)16-6-4-3-5-7-16/h3-12,21,24H,1-2H3/t21-/m0/s1 |
| InChIKey | NTISRUUIUIIELZ-NRFANRHFSA-N |
| XLogP | 6.44 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |