C6H4F3N3O — CID 21134653
5-(2,2-difluoroethenyl)-3-(1-fluoroethenoxy)-1H-1,2,4-triazole (PubChem CID 21134653) has the molecular formula C6H4F3N3O and a molecular weight of 191.11 g/mol. Its IUPAC name is 5-(2,2-difluoroethenyl)-3-(1-fluoroethenoxy)-1H-1,2,4-triazole.
| Compound Name | 5-(2,2-difluoroethenyl)-3-(1-fluoroethenoxy)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 21134653 |
| Molecular Formula | C6H4F3N3O |
| Molecular Weight | 191.11 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 5-(2,2-difluoroethenyl)-3-(1-fluoroethenoxy)-1H-1,2,4-triazole |
| SMILES | C=C(F)Oc1n[nH]c(C=C(F)F)n1 |
| InChI | InChI=1S/C6H4F3N3O/c1-3(7)13-6-10-5(11-12-6)2-4(8)9/h2H,1H2,(H,10,11,12) |
| InChIKey | IZJXNWNGPOZQLD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|