C8H16O — CID 21134687
4-methoxy-2,3-dimethylpent-2-ene (PubChem CID 21134687) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethylpent-2-ene.
| Compound Name | 4-methoxy-2,3-dimethylpent-2-ene |
|---|---|
| PubChem CID | 21134687 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 4-methoxy-2,3-dimethylpent-2-ene |
| SMILES | COC(C)C(C)=C(C)C |
| InChI | InChI=1S/C8H16O/c1-6(2)7(3)8(4)9-5/h8H,1-5H3 |
| InChIKey | MABNTHHEAOONJJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|