About phthalazin-6-ylmethanol
phthalazin-6-ylmethanol (PubChem CID 21134815) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is phthalazin-6-ylmethanol.
Molecular Properties
| Compound Name | phthalazin-6-ylmethanol |
| PubChem CID | 21134815 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | phthalazin-6-ylmethanol |
| SMILES | OCc1ccc2cnncc2c1 |
| InChI | InChI=1S/C9H8N2O/c12-6-7-1-2-8-4-10-11-5-9(8)3-7/h1-5,12H,6H2 |
| InChIKey | WEFUSGJWMMPSBM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phthalazin-6-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazin-6-ylmethanol?
The IUPAC name of phthalazin-6-ylmethanol (CID 21134815) is phthalazin-6-ylmethanol.
What is the SMILES notation for phthalazin-6-ylmethanol?
The canonical SMILES for phthalazin-6-ylmethanol is OCc1ccc2cnncc2c1.
What is the InChIKey of phthalazin-6-ylmethanol?
The InChIKey is WEFUSGJWMMPSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-6-7-1-2-8-4-10-11-5-9(8)3-7/h1-5,12H,6H2.
What are the key properties of phthalazin-6-ylmethanol?
phthalazin-6-ylmethanol has a molecular weight of 160.18 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazin-6-ylmethanol is sourced from PubChem (CID 21134815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).