About 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide
4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 2113483) has the molecular formula C16H13F3N2O2
and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
Molecular Properties
| Compound Name | 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| PubChem CID | 2113483 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-9-2-4-10(5-3-9)16(23)20-8-13(22)21-12-7-6-11(17)14(18)15(12)19/h2-7H,8H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | GUJZHCWCGRURFY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide?
The IUPAC name of 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (CID 2113483) is 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
What is the SMILES notation for 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide?
The canonical SMILES for 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide is Cc1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1.
What is the InChIKey of 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide?
The InChIKey is GUJZHCWCGRURFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2O2/c1-9-2-4-10(5-3-9)16(23)20-8-13(22)21-12-7-6-11(17)14(18)15(12)19/h2-7H,8H2,1H3,(H,20,23)(H,21,22).
What are the key properties of 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide?
4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide has a molecular weight of 322.29 g/mol, XLogP of 2.78, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide is sourced from PubChem (CID 2113483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).