C24H7NO4S — CID 21135098
N-(2,5-dihydroxyphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonayne-1-sulfonamide (PubChem CID 21135098) has the molecular formula C24H7NO4S and a molecular weight of 405.39 g/mol. Its IUPAC name is N-(2,5-dihydroxyphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonayne-1-sulfonamide.
| Compound Name | N-(2,5-dihydroxyphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonayne-1-sulfonamide |
|---|---|
| PubChem CID | 21135098 |
| Molecular Formula | C24H7NO4S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-(2,5-dihydroxyphenyl)octadeca-1,3,5,7,9,11,13,15,17-nonayne-1-sulfonamide |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CS(=O)(=O)Nc1cc(O)ccc1O |
| InChI | InChI=1S/C24H7NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-30(28,29)25-23-21-22(26)18-19-24(23)27/h1,18-19,21,25-27H |
| InChIKey | CVLLOQSEPZKSKT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|