C21H36O5 — CID 21135150
(13Z)-4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 21135150) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is (13Z)-4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 21135150 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (13Z)-4,8-dihydroxy-5,5,7,9,13,16-hexamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/CC(C)OC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCC1 |
| InChI | InChI=1S/C21H36O5/c1-13-8-7-9-14(2)19(24)16(4)20(25)21(5,6)17(22)12-18(23)26-15(3)11-10-13/h10,14-17,19,22,24H,7-9,11-12H2,1-6H3/b13-10- |
| InChIKey | SCGAGGBIPXUWHB-RAXLEYEMSA-N |
| XLogP | 3.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|