C10H18CuF6O4 — CID 21135174
copper;bis(1,1,1-trifluoropentane-2,4-diol) (PubChem CID 21135174) has the molecular formula C10H18CuF6O4 and a molecular weight of 379.78 g/mol. Its IUPAC name is copper;bis(1,1,1-trifluoropentane-2,4-diol).
| Compound Name | copper;bis(1,1,1-trifluoropentane-2,4-diol) |
|---|---|
| PubChem CID | 21135174 |
| Molecular Formula | C10H18CuF6O4 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | copper;bis(1,1,1-trifluoropentane-2,4-diol) |
| SMILES | CC(O)CC(O)C(F)(F)F.CC(O)CC(O)C(F)(F)F.[Cu] |
| InChI | InChI=1S/2C5H9F3O2.Cu/c2*1-3(9)2-4(10)5(6,7)8;/h2*3-4,9-10H,2H2,1H3; |
| InChIKey | OCMAALLJJFZXGL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |