C19H26N2+2 — CID 21135180
1,1,3,3,6-pentamethyl-8-phenyl-2,4-dihydroquinazoline-1,3-diium (PubChem CID 21135180) has the molecular formula C19H26N2+2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,1,3,3,6-pentamethyl-8-phenyl-2,4-dihydroquinazoline-1,3-diium.
| Compound Name | 1,1,3,3,6-pentamethyl-8-phenyl-2,4-dihydroquinazoline-1,3-diium |
|---|---|
| PubChem CID | 21135180 |
| Molecular Formula | C19H26N2+2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1,1,3,3,6-pentamethyl-8-phenyl-2,4-dihydroquinazoline-1,3-diium |
| SMILES | Cc1cc2c(c(-c3ccccc3)c1)[N+](C)(C)C[N+](C)(C)C2 |
| InChI | InChI=1S/C19H26N2/c1-15-11-17-13-20(2,3)14-21(4,5)19(17)18(12-15)16-9-7-6-8-10-16/h6-12H,13-14H2,1-5H3/q+2 |
| InChIKey | QPMAZQHDRUECBG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|