C24H34NS+ — CID 21135373
6,8-ditert-butyl-3,4-dimethyl-3-phenyl-2,4-dihydro-1,3-benzothiazin-3-ium (PubChem CID 21135373) has the molecular formula C24H34NS+ and a molecular weight of 368.61 g/mol. Its IUPAC name is 6,8-ditert-butyl-3,4-dimethyl-3-phenyl-2,4-dihydro-1,3-benzothiazin-3-ium.
| Compound Name | 6,8-ditert-butyl-3,4-dimethyl-3-phenyl-2,4-dihydro-1,3-benzothiazin-3-ium |
|---|---|
| PubChem CID | 21135373 |
| Molecular Formula | C24H34NS+ |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 6,8-ditert-butyl-3,4-dimethyl-3-phenyl-2,4-dihydro-1,3-benzothiazin-3-ium |
| SMILES | CC1c2cc(C(C)(C)C)cc(C(C)(C)C)c2SC[N+]1(C)c1ccccc1 |
| InChI | InChI=1S/C24H34NS/c1-17-20-14-18(23(2,3)4)15-21(24(5,6)7)22(20)26-16-25(17,8)19-12-10-9-11-13-19/h9-15,17H,16H2,1-8H3/q+1 |
| InChIKey | DMHUNUFRESSWFM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|