C40H42N2O2+2 — CID 21135377
3'-(2,6-dimethylphenyl)-3,3',6,6',8-pentamethyl-3,8'-diphenyl-2,2'-spirobi[4H-1,3-benzoxazin-3-ium] (PubChem CID 21135377) has the molecular formula C40H42N2O2+2 and a molecular weight of 582.79 g/mol. Its IUPAC name is 3'-(2,6-dimethylphenyl)-3,3',6,6',8-pentamethyl-3,8'-diphenyl-2,2'-spirobi[4H-1,3-benzoxazin-3-ium].
| Compound Name | 3'-(2,6-dimethylphenyl)-3,3',6,6',8-pentamethyl-3,8'-diphenyl-2,2'-spirobi[4H-1,3-benzoxazin-3-ium] |
|---|---|
| PubChem CID | 21135377 |
| Molecular Formula | C40H42N2O2+2 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 3'-(2,6-dimethylphenyl)-3,3',6,6',8-pentamethyl-3,8'-diphenyl-2,2'-spirobi[4H-1,3-benzoxazin-3-ium] |
| SMILES | Cc1cc(C)c2c(c1)C[N+](C)(c1ccccc1)C1(O2)Oc2c(cc(C)cc2-c2ccccc2)C[N+]1(C)c1c(C)cccc1C |
| InChI | InChI=1S/C40H42N2O2/c1-27-21-31(5)38-33(22-27)25-41(6,35-19-12-9-13-20-35)40(43-38)42(7,37-29(3)15-14-16-30(37)4)26-34-23-28(2)24-36(39(34)44-40)32-17-10-8-11-18-32/h8-24H,25-26H2,1-7H3/q+2 |
| InChIKey | VRLLQDGXGCDBTE-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|