About 3-phenyl-2,4-dihydro-1,3-benzothiazine
3-phenyl-2,4-dihydro-1,3-benzothiazine (PubChem CID 21135400) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-phenyl-2,4-dihydro-1,3-benzothiazine.
Molecular Properties
| Compound Name | 3-phenyl-2,4-dihydro-1,3-benzothiazine |
| PubChem CID | 21135400 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-phenyl-2,4-dihydro-1,3-benzothiazine |
| SMILES | c1ccc(N2CSc3ccccc3C2)cc1 |
| InChI | InChI=1S/C14H13NS/c1-2-7-13(8-3-1)15-10-12-6-4-5-9-14(12)16-11-15/h1-9H,10-11H2 |
| InChIKey | FBIOPIHITXTIGE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-2,4-dihydro-1,3-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2,4-dihydro-1,3-benzothiazine?
The IUPAC name of 3-phenyl-2,4-dihydro-1,3-benzothiazine (CID 21135400) is 3-phenyl-2,4-dihydro-1,3-benzothiazine.
What is the SMILES notation for 3-phenyl-2,4-dihydro-1,3-benzothiazine?
The canonical SMILES for 3-phenyl-2,4-dihydro-1,3-benzothiazine is c1ccc(N2CSc3ccccc3C2)cc1.
What is the InChIKey of 3-phenyl-2,4-dihydro-1,3-benzothiazine?
The InChIKey is FBIOPIHITXTIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS/c1-2-7-13(8-3-1)15-10-12-6-4-5-9-14(12)16-11-15/h1-9H,10-11H2.
What are the key properties of 3-phenyl-2,4-dihydro-1,3-benzothiazine?
3-phenyl-2,4-dihydro-1,3-benzothiazine has a molecular weight of 227.33 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2,4-dihydro-1,3-benzothiazine is sourced from PubChem (CID 21135400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).