C23H32N2O3Si2 — CID 21135410
4,6,11,11,13,13,18,20-octamethyl-2,12,22-trioxa-10,14-diaza-11,13-disilapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3,5,7,16,18,20-hexaene (PubChem CID 21135410) has the molecular formula C23H32N2O3Si2 and a molecular weight of 440.69 g/mol. Its IUPAC name is 4,6,11,11,13,13,18,20-octamethyl-2,12,22-trioxa-10,14-diaza-11,13-disilapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3,5,7,16,18,20-hexaene.
| Compound Name | 4,6,11,11,13,13,18,20-octamethyl-2,12,22-trioxa-10,14-diaza-11,13-disilapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3,5,7,16,18,20-hexaene |
|---|---|
| PubChem CID | 21135410 |
| Molecular Formula | C23H32N2O3Si2 |
| Molecular Weight | 440.69 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4,6,11,11,13,13,18,20-octamethyl-2,12,22-trioxa-10,14-diaza-11,13-disilapentacyclo[12.8.0.01,10.03,8.016,21]docosa-3,5,7,16,18,20-hexaene |
| SMILES | Cc1cc(C)c2c(c1)CN1C3(O2)Oc2c(C)cc(C)cc2CN3[Si](C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C23H32N2O3Si2/c1-15-9-17(3)21-19(11-15)13-24-23(26-21)25(30(7,8)28-29(24,5)6)14-20-12-16(2)10-18(4)22(20)27-23/h9-12H,13-14H2,1-8H3 |
| InChIKey | MFBHTEHNQUDOQC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|