About 7H-pyrrolo[3,2-d]pyrimidin-4-amine
7H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 21135538) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 7H-pyrrolo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7H-pyrrolo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 21135538 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 7H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1N=CC2 |
| InChI | InChI=1S/C6H6N4/c7-6-5-4(1-2-8-5)9-3-10-6/h2-3H,1H2,(H2,7,9,10) |
| InChIKey | KDLBPMLXOZTGDT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7H-pyrrolo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 7H-pyrrolo[3,2-d]pyrimidin-4-amine (CID 21135538) is 7H-pyrrolo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 7H-pyrrolo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 7H-pyrrolo[3,2-d]pyrimidin-4-amine is Nc1ncnc2c1N=CC2.
What is the InChIKey of 7H-pyrrolo[3,2-d]pyrimidin-4-amine?
The InChIKey is KDLBPMLXOZTGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c7-6-5-4(1-2-8-5)9-3-10-6/h2-3H,1H2,(H2,7,9,10).
What are the key properties of 7H-pyrrolo[3,2-d]pyrimidin-4-amine?
7H-pyrrolo[3,2-d]pyrimidin-4-amine has a molecular weight of 134.14 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 21135538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).