C16H19N2OS+ — CID 21136177
2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone (PubChem CID 21136177) has the molecular formula C16H19N2OS+ and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone.
| Compound Name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 21136177 |
| Molecular Formula | C16H19N2OS+ |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)C[n+]2c(N)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C16H18N2OS/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17/h6-9,17H,2-5,10H2,1H3/p+1 |
| InChIKey | OLTZHXYLLRJLST-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|