C23H39O3P — CID 21136348
5-butyl-2-(2,4-ditert-butylphenoxy)-5-ethyl-1,3,2-dioxaphosphinane (PubChem CID 21136348) has the molecular formula C23H39O3P and a molecular weight of 394.54 g/mol. Its IUPAC name is 5-butyl-2-(2,4-ditert-butylphenoxy)-5-ethyl-1,3,2-dioxaphosphinane.
| Compound Name | 5-butyl-2-(2,4-ditert-butylphenoxy)-5-ethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 21136348 |
| Molecular Formula | C23H39O3P |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 5-butyl-2-(2,4-ditert-butylphenoxy)-5-ethyl-1,3,2-dioxaphosphinane |
| SMILES | CCCCC1(CC)COP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)OC1 |
| InChI | InChI=1S/C23H39O3P/c1-9-11-14-23(10-2)16-24-27(25-17-23)26-20-13-12-18(21(3,4)5)15-19(20)22(6,7)8/h12-13,15H,9-11,14,16-17H2,1-8H3 |
| InChIKey | QVMYIRZGAVKTMG-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|