C14H25NO5 — CID 21136454
3-O-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)methyl] 1-O-methyl propanedioate (PubChem CID 21136454) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-O-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)methyl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)methyl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 21136454 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-O-[(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)methyl] 1-O-methyl propanedioate |
| SMILES | COC(=O)CC(=O)OCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C14H25NO5/c1-13(2)7-10(16)8-14(3,4)15(13)9-20-12(18)6-11(17)19-5/h10,16H,6-9H2,1-5H3 |
| InChIKey | MKVXVJSRTJKVHW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|