C18H20I2N2O3S — CID 21137538
N-[1-[(3,5-diiodo-4-methylphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide (PubChem CID 21137538) has the molecular formula C18H20I2N2O3S and a molecular weight of 598.24 g/mol. Its IUPAC name is N-[1-[(3,5-diiodo-4-methylphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide.
| Compound Name | N-[1-[(3,5-diiodo-4-methylphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 21137538 |
| Molecular Formula | C18H20I2N2O3S |
| Molecular Weight | 598.24 g/mol |
| Exact Mass | 597.93 |
| IUPAC Name | N-[1-[(3,5-diiodo-4-methylphenyl)methyl]-6-hydroxy-1,2,3,4-tetrahydroisoquinolin-7-yl]methanesulfonamide |
| SMILES | Cc1c(I)cc(CC2NCCc3cc(O)c(NS(C)(=O)=O)cc32)cc1I |
| InChI | InChI=1S/C18H20I2N2O3S/c1-10-14(19)5-11(6-15(10)20)7-16-13-9-17(22-26(2,24)25)18(23)8-12(13)3-4-21-16/h5-6,8-9,16,21-23H,3-4,7H2,1-2H3 |
| InChIKey | XHFNVXYCIVRBTI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|