About 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate
4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate (PubChem CID 21137992) has the molecular formula C18H29N3O3S3
and a molecular weight of 431.65 g/mol. Its IUPAC name is 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate.
Molecular Properties
| Compound Name | 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate |
| PubChem CID | 21137992 |
| Molecular Formula | C18H29N3O3S3 |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate |
| SMILES | N#COCCCCSCC(CSCCCCN=C=O)SCCCCN=C=O |
| InChI | InChI=1S/C18H29N3O3S3/c19-15-24-9-3-6-11-26-14-18(27-12-5-2-8-21-17-23)13-25-10-4-1-7-20-16-22/h18H,1-14H2 |
| InChIKey | MMVPXASZWZONDA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate?
The IUPAC name of 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate (CID 21137992) is 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate.
What is the SMILES notation for 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate?
The canonical SMILES for 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate is N#COCCCCSCC(CSCCCCN=C=O)SCCCCN=C=O.
What is the InChIKey of 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate?
The InChIKey is MMVPXASZWZONDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O3S3/c19-15-24-9-3-6-11-26-14-18(27-12-5-2-8-21-17-23)13-25-10-4-1-7-20-16-22/h18H,1-14H2.
What are the key properties of 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate?
4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate has a molecular weight of 431.65 g/mol, XLogP of 4.06, 20 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,3-bis(4-isocyanatobutylsulfanyl)propylsulfanyl]butyl cyanate is sourced from PubChem (CID 21137992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).