About 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate
3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate (PubChem CID 21137993) has the molecular formula C15H23N3O3S3
and a molecular weight of 389.57 g/mol. Its IUPAC name is 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate.
Molecular Properties
| Compound Name | 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate |
| PubChem CID | 21137993 |
| Molecular Formula | C15H23N3O3S3 |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate |
| SMILES | N#COCCCSCC(CSCCCN=C=O)SCCCN=C=O |
| InChI | InChI=1S/C15H23N3O3S3/c16-12-21-6-3-8-23-11-15(24-9-2-5-18-14-20)10-22-7-1-4-17-13-19/h15H,1-11H2 |
| InChIKey | WXPFKEPFBOQSSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate?
The IUPAC name of 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate (CID 21137993) is 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate.
What is the SMILES notation for 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate?
The canonical SMILES for 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate is N#COCCCSCC(CSCCCN=C=O)SCCCN=C=O.
What is the InChIKey of 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate?
The InChIKey is WXPFKEPFBOQSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O3S3/c16-12-21-6-3-8-23-11-15(24-9-2-5-18-14-20)10-22-7-1-4-17-13-19/h15H,1-11H2.
What are the key properties of 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate?
3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate has a molecular weight of 389.57 g/mol, XLogP of 2.89, 17 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-bis(3-isocyanatopropylsulfanyl)propylsulfanyl]propyl cyanate is sourced from PubChem (CID 21137993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).