C19H12F2N4 — CID 21138109
5-[(2E)-6-fluoro-5-(1-fluorohexa-1,2,3,4,5-pentaenyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole (PubChem CID 21138109) has the molecular formula C19H12F2N4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 5-[(2E)-6-fluoro-5-(1-fluorohexa-1,2,3,4,5-pentaenyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole.
| Compound Name | 5-[(2E)-6-fluoro-5-(1-fluorohexa-1,2,3,4,5-pentaenyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole |
|---|---|
| PubChem CID | 21138109 |
| Molecular Formula | C19H12F2N4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-[(2E)-6-fluoro-5-(1-fluorohexa-1,2,3,4,5-pentaenyl)undeca-2,4,6,7,8,9,10-heptaen-4-yl]-1-methyltetrazole |
| SMILES | C=C=C=C=C=C(F)C(C(F)=C=C=C=C=C)=C(/C=C/C)c1nnnn1C |
| InChI | InChI=1S/C19H12F2N4/c1-5-8-10-13-16(20)18(17(21)14-11-9-6-2)15(12-7-3)19-22-23-24-25(19)4/h7,12H,1-2H2,3-4H3/b12-7+ |
| InChIKey | OBCSISGBFVNJHX-KPKJPENVSA-N |
| XLogP | 3.75 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|