C30H44O5 — CID 21138129
8-[(8S,11S,13S,14S,17S)-17-acetyloxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]octyl acetate (PubChem CID 21138129) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is 8-[(8S,11S,13S,14S,17S)-17-acetyloxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]octyl acetate.
| Compound Name | 8-[(8S,11S,13S,14S,17S)-17-acetyloxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]octyl acetate |
|---|---|
| PubChem CID | 21138129 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 8-[(8S,11S,13S,14S,17S)-17-acetyloxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]octyl acetate |
| SMILES | CC(=O)OCCCCCCCC[C@H]1C[C@]2(C)[C@@H](OC(C)=O)CC[C@H]2[C@@H]2CCC3=CC(=O)CCC3=C12 |
| InChI | InChI=1S/C30H44O5/c1-20(31)34-17-9-7-5-4-6-8-10-23-19-30(3)27(15-16-28(30)35-21(2)32)26-13-11-22-18-24(33)12-14-25(22)29(23)26/h18,23,26-28H,4-17,19H2,1-3H3/t23-,26-,27-,28-,30-/m0/s1 |
| InChIKey | BOBGIUZUVHZDMD-NFWZRYHXSA-N |
| XLogP | 6.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|