C34H43F5O4S — CID 21138144
(8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 21138144) has the molecular formula C34H43F5O4S and a molecular weight of 642.77 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 21138144 |
| Molecular Formula | C34H43F5O4S |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | (8S,9R,11S,13S,14S)-13-methyl-11-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCc3cc(O)ccc3[C@H]1[C@@H](c1ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C34H43F5O4S/c1-32-16-5-7-30(32)28-14-10-24-21-25(40)11-15-27(24)31(28)29(22-32)23-8-12-26(13-9-23)43-18-3-2-4-19-44(41,42)20-6-17-33(35,36)34(37,38)39/h8-9,11-13,15,21,28-31,40H,2-7,10,14,16-20,22H2,1H3/t28-,29+,30-,31+,32-/m0/s1 |
| InChIKey | DOWPJESPVHZPFA-YTSIGKGGSA-N |
| XLogP | 8.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|