About CID 21138295
CID 21138295 (PubChem CID 21138295) has the molecular formula C17BN7
and a molecular weight of 313.05 g/mol.
Molecular Properties
| Compound Name | CID 21138295 |
| PubChem CID | 21138295 |
| Molecular Formula | C17BN7 |
| Molecular Weight | 313.05 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | — |
| SMILES | [B]c1c([N+]#[C-])c(C#N)c2c(C#N)c(C#N)c(C#N)c(C#N)c2c1C#N |
| InChI | InChI=1S/C17BN7/c1-25-17-13(7-24)15-11(5-22)9(3-20)8(2-19)10(4-21)14(15)12(6-23)16(17)18 |
| InChIKey | BIAHQPCVUWBRGK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 147.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.05 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21138295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21138295?
The IUPAC name of CID 21138295 (CID 21138295) is not available.
What is the SMILES notation for CID 21138295?
The canonical SMILES for CID 21138295 is [B]c1c([N+]#[C-])c(C#N)c2c(C#N)c(C#N)c(C#N)c(C#N)c2c1C#N.
What is the InChIKey of CID 21138295?
The InChIKey is BIAHQPCVUWBRGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17BN7/c1-25-17-13(7-24)15-11(5-22)9(3-20)8(2-19)10(4-21)14(15)12(6-23)16(17)18.
What are the key properties of CID 21138295?
CID 21138295 has a molecular weight of 313.05 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21138295 is sourced from PubChem (CID 21138295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).