About (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate
(4-cyano-3,5-difluorophenyl) 4-pentylbenzoate (PubChem CID 21138476) has the molecular formula C19H17F2NO2
and a molecular weight of 329.35 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate.
Molecular Properties
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate |
| PubChem CID | 21138476 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2cc(F)c(C#N)c(F)c2)cc1 |
| InChI | InChI=1S/C19H17F2NO2/c1-2-3-4-5-13-6-8-14(9-7-13)19(23)24-15-10-17(20)16(12-22)18(21)11-15/h6-11H,2-5H2,1H3 |
| InChIKey | ZSDURCFSQJERPJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate?
The IUPAC name of (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate (CID 21138476) is (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate.
What is the SMILES notation for (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate?
The canonical SMILES for (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate is CCCCCc1ccc(C(=O)Oc2cc(F)c(C#N)c(F)c2)cc1.
What is the InChIKey of (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate?
The InChIKey is ZSDURCFSQJERPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2NO2/c1-2-3-4-5-13-6-8-14(9-7-13)19(23)24-15-10-17(20)16(12-22)18(21)11-15/h6-11H,2-5H2,1H3.
What are the key properties of (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate?
(4-cyano-3,5-difluorophenyl) 4-pentylbenzoate has a molecular weight of 329.35 g/mol, XLogP of 4.79, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-3,5-difluorophenyl) 4-pentylbenzoate is sourced from PubChem (CID 21138476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).