About 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one
2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one (PubChem CID 21138866) has the molecular formula C9H6O5P-
and a molecular weight of 225.12 g/mol. Its IUPAC name is 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one.
Molecular Properties
| Compound Name | 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one |
| PubChem CID | 21138866 |
| Molecular Formula | C9H6O5P- |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one |
| SMILES | O=C1C=C(c2ccccc2)OP(=O)([O-])O1 |
| InChI | InChI=1S/C9H7O5P/c10-9-6-8(13-15(11,12)14-9)7-4-2-1-3-5-7/h1-6H,(H,11,12)/p-1 |
| InChIKey | VEZAQLRHJGJNFP-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one?
The IUPAC name of 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one (CID 21138866) is 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one.
What is the SMILES notation for 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one?
The canonical SMILES for 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one is O=C1C=C(c2ccccc2)OP(=O)([O-])O1.
What is the InChIKey of 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one?
The InChIKey is VEZAQLRHJGJNFP-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7O5P/c10-9-6-8(13-15(11,12)14-9)7-4-2-1-3-5-7/h1-6H,(H,11,12)/p-1.
What are the key properties of 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one?
2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one has a molecular weight of 225.12 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxido-2-oxo-6-phenyl-1,3,2λ5-dioxaphosphinin-4-one is sourced from PubChem (CID 21138866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).