About 4H-thieno[3,2-c]chromene-2-carboxylate
4H-thieno[3,2-c]chromene-2-carboxylate (PubChem CID 2113887) has the molecular formula C12H7O3S-
and a molecular weight of 231.25 g/mol. Its IUPAC name is 4H-thieno[3,2-c]chromene-2-carboxylate.
Molecular Properties
| Compound Name | 4H-thieno[3,2-c]chromene-2-carboxylate |
| PubChem CID | 2113887 |
| Molecular Formula | C12H7O3S- |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 4H-thieno[3,2-c]chromene-2-carboxylate |
| SMILES | O=C([O-])c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C12H8O3S/c13-12(14)10-5-7-6-15-9-4-2-1-3-8(9)11(7)16-10/h1-5H,6H2,(H,13,14)/p-1 |
| InChIKey | ZMEWPWRPNHFDRC-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-thieno[3,2-c]chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-thieno[3,2-c]chromene-2-carboxylate?
The IUPAC name of 4H-thieno[3,2-c]chromene-2-carboxylate (CID 2113887) is 4H-thieno[3,2-c]chromene-2-carboxylate.
What is the SMILES notation for 4H-thieno[3,2-c]chromene-2-carboxylate?
The canonical SMILES for 4H-thieno[3,2-c]chromene-2-carboxylate is O=C([O-])c1cc2c(s1)-c1ccccc1OC2.
What is the InChIKey of 4H-thieno[3,2-c]chromene-2-carboxylate?
The InChIKey is ZMEWPWRPNHFDRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H8O3S/c13-12(14)10-5-7-6-15-9-4-2-1-3-8(9)11(7)16-10/h1-5H,6H2,(H,13,14)/p-1.
What are the key properties of 4H-thieno[3,2-c]chromene-2-carboxylate?
4H-thieno[3,2-c]chromene-2-carboxylate has a molecular weight of 231.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-thieno[3,2-c]chromene-2-carboxylate is sourced from PubChem (CID 2113887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).