C10H17N2S+ — CID 21139023
2,6,6-trimethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ium (PubChem CID 21139023) has the molecular formula C10H17N2S+ and a molecular weight of 197.33 g/mol. Its IUPAC name is 2,6,6-trimethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ium.
| Compound Name | 2,6,6-trimethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ium |
|---|---|
| PubChem CID | 21139023 |
| Molecular Formula | C10H17N2S+ |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2,6,6-trimethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ium |
| SMILES | Cc1nc2c(s1)CC[N+](C)(C)CC2 |
| InChI | InChI=1S/C10H17N2S/c1-8-11-9-4-6-12(2,3)7-5-10(9)13-8/h4-7H2,1-3H3/q+1 |
| InChIKey | NNTMMODVWCRTKT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|