C17H21NO2 — CID 21139289
(1R,5R)-1,8,8-trimethyl-3-(2-methylphenyl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 21139289) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,5R)-1,8,8-trimethyl-3-(2-methylphenyl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5R)-1,8,8-trimethyl-3-(2-methylphenyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 21139289 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R,5R)-1,8,8-trimethyl-3-(2-methylphenyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1ccccc1N1C(=O)[C@@H]2CC[C@@](C)(C1=O)C2(C)C |
| InChI | InChI=1S/C17H21NO2/c1-11-7-5-6-8-13(11)18-14(19)12-9-10-17(4,15(18)20)16(12,2)3/h5-8,12H,9-10H2,1-4H3/t12-,17-/m0/s1 |
| InChIKey | RSPVWGQFXBRKRG-SJCJKPOMSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|