C24H31NO7 — CID 21139557
4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione;3-oxo-3-phenylpropanoic acid (PubChem CID 21139557) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione;3-oxo-3-phenylpropanoic acid.
| Compound Name | 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione;3-oxo-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 21139557 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione;3-oxo-3-phenylpropanoic acid |
| SMILES | C[C@@H]1C[C@@H]([C@H](O)CC2CC(=O)NC(=O)C2)C(=O)[C@@H](C)C1.O=C(O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO4.C9H8O3/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10;10-8(6-9(11)12)7-4-2-1-3-5-7/h8-12,17H,3-7H2,1-2H3,(H,16,18,19);1-5H,6H2,(H,11,12)/t8-,9-,11-,12+;/m0./s1 |
| InChIKey | USPHHIUHZRPRNR-GVDGCEAISA-N |
| XLogP | 2.39 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|