C10H13NO3 — CID 21139597
(2S,3R)-2-amino-3-methoxy-3-phenylpropanoic acid (PubChem CID 21139597) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-methoxy-3-phenylpropanoic acid.
| Compound Name | (2S,3R)-2-amino-3-methoxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 21139597 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2S,3R)-2-amino-3-methoxy-3-phenylpropanoic acid |
| SMILES | CO[C@H](c1ccccc1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H13NO3/c1-14-9(8(11)10(12)13)7-5-3-2-4-6-7/h2-6,8-9H,11H2,1H3,(H,12,13)/t8-,9+/m0/s1 |
| InChIKey | KKXIHXAQVMPMHW-DTWKUNHWSA-N |
| XLogP | 0.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |