C17H20O4S2 — CID 21139961
(2R,3R,4R)-5,5-bis(phenylsulfanyl)pentane-1,2,3,4-tetrol (PubChem CID 21139961) has the molecular formula C17H20O4S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2R,3R,4R)-5,5-bis(phenylsulfanyl)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4R)-5,5-bis(phenylsulfanyl)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 21139961 |
| Molecular Formula | C17H20O4S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (2R,3R,4R)-5,5-bis(phenylsulfanyl)pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C17H20O4S2/c18-11-14(19)15(20)16(21)17(22-12-7-3-1-4-8-12)23-13-9-5-2-6-10-13/h1-10,14-21H,11H2/t14-,15-,16-/m1/s1 |
| InChIKey | KSOONRGIPJUSRL-BZUAXINKSA-N |
| XLogP | 1.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|