C11H26Cl2N2 — CID 21140406
2-chloro-N,N,N',N'-tetraethylpropane-1,3-diamine;hydrochloride (PubChem CID 21140406) has the molecular formula C11H26Cl2N2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-chloro-N,N,N',N'-tetraethylpropane-1,3-diamine;hydrochloride.
| Compound Name | 2-chloro-N,N,N',N'-tetraethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 21140406 |
| Molecular Formula | C11H26Cl2N2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-chloro-N,N,N',N'-tetraethylpropane-1,3-diamine;hydrochloride |
| SMILES | CCN(CC)CC(Cl)CN(CC)CC.Cl |
| InChI | InChI=1S/C11H25ClN2.ClH/c1-5-13(6-2)9-11(12)10-14(7-3)8-4;/h11H,5-10H2,1-4H3;1H |
| InChIKey | NCSOKUUVWFBNOC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|