About benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane
benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane (PubChem CID 21140435) has the molecular formula C12H24O3Si2
and a molecular weight of 272.49 g/mol. Its IUPAC name is benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 21140435 |
| Molecular Formula | C12H24O3Si2 |
| Molecular Weight | 272.49 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C6H18OSi2/c7-5-1-2-6(8)4-3-5;1-8(2,3)7-9(4,5)6/h1-4,7-8H;1-6H3 |
| InChIKey | BMRPOJHQDLHAGM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane (CID 21140435) is benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane is C[Si](C)(C)O[Si](C)(C)C.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane?
The InChIKey is BMRPOJHQDLHAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C6H18OSi2/c7-5-1-2-6(8)4-3-5;1-8(2,3)7-9(4,5)6/h1-4,7-8H;1-6H3.
What are the key properties of benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane?
benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane has a molecular weight of 272.49 g/mol, XLogP of 3.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 21140435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).