C41H32O11 — CID 21140663
[(2R,3R,4S,5S)-2,3,4,5-tetrabenzoyloxy-6-oxohexyl] benzoate (PubChem CID 21140663) has the molecular formula C41H32O11 and a molecular weight of 700.70 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,3,4,5-tetrabenzoyloxy-6-oxohexyl] benzoate.
| Compound Name | [(2R,3R,4S,5S)-2,3,4,5-tetrabenzoyloxy-6-oxohexyl] benzoate |
|---|---|
| PubChem CID | 21140663 |
| Molecular Formula | C41H32O11 |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | [(2R,3R,4S,5S)-2,3,4,5-tetrabenzoyloxy-6-oxohexyl] benzoate |
| SMILES | O=C[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H32O11/c42-26-33(49-38(44)29-18-8-2-9-19-29)35(51-40(46)31-22-12-4-13-23-31)36(52-41(47)32-24-14-5-15-25-32)34(50-39(45)30-20-10-3-11-21-30)27-48-37(43)28-16-6-1-7-17-28/h1-26,33-36H,27H2/t33-,34-,35-,36-/m1/s1 |
| InChIKey | SIPWCDUYKOLEKU-MGXDLYCJSA-N |
| XLogP | 5.94 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|